C36H53NO2 — CID 67898297
1-hexyl-3-[4-[4-(11-hydroxyundecan-4-yloxy)phenyl]phenyl]cyclohexane-1-carbonitrile (PubChem CID 67898297) has the molecular formula C36H53NO2 and a molecular weight of 531.83 g/mol. Its IUPAC name is 1-hexyl-3-[4-[4-(11-hydroxyundecan-4-yloxy)phenyl]phenyl]cyclohexane-1-carbonitrile.
| Compound Name | 1-hexyl-3-[4-[4-(11-hydroxyundecan-4-yloxy)phenyl]phenyl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 67898297 |
| Molecular Formula | C36H53NO2 |
| Molecular Weight | 531.83 g/mol |
| Exact Mass | 531.41 |
| IUPAC Name | 1-hexyl-3-[4-[4-(11-hydroxyundecan-4-yloxy)phenyl]phenyl]cyclohexane-1-carbonitrile |
| SMILES | CCCCCCC1(C#N)CCCC(c2ccc(-c3ccc(OC(CCC)CCCCCCCO)cc3)cc2)C1 |
| InChI | InChI=1S/C36H53NO2/c1-3-5-6-11-25-36(29-37)26-13-15-33(28-36)32-19-17-30(18-20-32)31-21-23-35(24-22-31)39-34(14-4-2)16-10-8-7-9-12-27-38/h17-24,33-34,38H,3-16,25-28H2,1-2H3 |
| InChIKey | CUOFOALJKVCYLF-UHFFFAOYSA-N |
| XLogP | 10.37 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.83 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|