C33H47NO2 — CID 67898173
3-[4-(4-heptan-4-yloxyphenyl)phenyl]-1-(7-hydroxyheptyl)cyclohexane-1-carbonitrile (PubChem CID 67898173) has the molecular formula C33H47NO2 and a molecular weight of 489.74 g/mol. Its IUPAC name is 3-[4-(4-heptan-4-yloxyphenyl)phenyl]-1-(7-hydroxyheptyl)cyclohexane-1-carbonitrile.
| Compound Name | 3-[4-(4-heptan-4-yloxyphenyl)phenyl]-1-(7-hydroxyheptyl)cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 67898173 |
| Molecular Formula | C33H47NO2 |
| Molecular Weight | 489.74 g/mol |
| Exact Mass | 489.36 |
| IUPAC Name | 3-[4-(4-heptan-4-yloxyphenyl)phenyl]-1-(7-hydroxyheptyl)cyclohexane-1-carbonitrile |
| SMILES | CCCC(CCC)Oc1ccc(-c2ccc(C3CCCC(C#N)(CCCCCCCO)C3)cc2)cc1 |
| InChI | InChI=1S/C33H47NO2/c1-3-11-31(12-4-2)36-32-20-18-28(19-21-32)27-14-16-29(17-15-27)30-13-10-23-33(25-30,26-34)22-8-6-5-7-9-24-35/h14-21,30-31,35H,3-13,22-25H2,1-2H3 |
| InChIKey | HVEMWGAOECMIHV-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.74 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|