C29H39NO — CID 67898458
3-[4-(4-ethylphenyl)phenyl]-1-(8-hydroxyoctyl)cyclohexane-1-carbonitrile (PubChem CID 67898458) has the molecular formula C29H39NO and a molecular weight of 417.64 g/mol. Its IUPAC name is 3-[4-(4-ethylphenyl)phenyl]-1-(8-hydroxyoctyl)cyclohexane-1-carbonitrile.
| Compound Name | 3-[4-(4-ethylphenyl)phenyl]-1-(8-hydroxyoctyl)cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 67898458 |
| Molecular Formula | C29H39NO |
| Molecular Weight | 417.64 g/mol |
| Exact Mass | 417.30 |
| IUPAC Name | 3-[4-(4-ethylphenyl)phenyl]-1-(8-hydroxyoctyl)cyclohexane-1-carbonitrile |
| SMILES | CCc1ccc(-c2ccc(C3CCCC(C#N)(CCCCCCCCO)C3)cc2)cc1 |
| InChI | InChI=1S/C29H39NO/c1-2-24-11-13-25(14-12-24)26-15-17-27(18-16-26)28-10-9-20-29(22-28,23-30)19-7-5-3-4-6-8-21-31/h11-18,28,31H,2-10,19-22H2,1H3 |
| InChIKey | DZIZLWVDZCRAIV-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.64 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|