C31H43NO2 — CID 67898495
3-[4-[4-(1-hydroxybutoxy)phenyl]phenyl]-1-octylcyclohexane-1-carbonitrile (PubChem CID 67898495) has the molecular formula C31H43NO2 and a molecular weight of 461.69 g/mol. Its IUPAC name is 3-[4-[4-(1-hydroxybutoxy)phenyl]phenyl]-1-octylcyclohexane-1-carbonitrile.
| Compound Name | 3-[4-[4-(1-hydroxybutoxy)phenyl]phenyl]-1-octylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 67898495 |
| Molecular Formula | C31H43NO2 |
| Molecular Weight | 461.69 g/mol |
| Exact Mass | 461.33 |
| IUPAC Name | 3-[4-[4-(1-hydroxybutoxy)phenyl]phenyl]-1-octylcyclohexane-1-carbonitrile |
| SMILES | CCCCCCCCC1(C#N)CCCC(c2ccc(-c3ccc(OC(O)CCC)cc3)cc2)C1 |
| InChI | InChI=1S/C31H43NO2/c1-3-5-6-7-8-9-21-31(24-32)22-10-12-28(23-31)27-15-13-25(14-16-27)26-17-19-29(20-18-26)34-30(33)11-4-2/h13-20,28,30,33H,3-12,21-23H2,1-2H3 |
| InChIKey | YLDURLITDGXWCN-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.69 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|