C35H47NO3 — CID 67898147
6-[1-cyano-3-[4-(4-heptan-4-yloxyphenyl)phenyl]cyclohexyl]hexyl prop-2-enoate (PubChem CID 67898147) has the molecular formula C35H47NO3 and a molecular weight of 529.77 g/mol. Its IUPAC name is 6-[1-cyano-3-[4-(4-heptan-4-yloxyphenyl)phenyl]cyclohexyl]hexyl prop-2-enoate.
| Compound Name | 6-[1-cyano-3-[4-(4-heptan-4-yloxyphenyl)phenyl]cyclohexyl]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 67898147 |
| Molecular Formula | C35H47NO3 |
| Molecular Weight | 529.77 g/mol |
| Exact Mass | 529.36 |
| IUPAC Name | 6-[1-cyano-3-[4-(4-heptan-4-yloxyphenyl)phenyl]cyclohexyl]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCC1(C#N)CCCC(c2ccc(-c3ccc(OC(CCC)CCC)cc3)cc2)C1 |
| InChI | InChI=1S/C35H47NO3/c1-4-12-32(13-5-2)39-33-21-19-29(20-22-33)28-15-17-30(18-16-28)31-14-11-24-35(26-31,27-36)23-9-7-8-10-25-38-34(37)6-3/h6,15-22,31-32H,3-5,7-14,23-26H2,1-2H3 |
| InChIKey | PCJDEKZOMZAPLF-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.77 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|