C31H39NO2 — CID 67898507
5-[3-[3-(4-butylphenyl)phenyl]-1-cyanocyclohexyl]pentyl prop-2-enoate (PubChem CID 67898507) has the molecular formula C31H39NO2 and a molecular weight of 457.66 g/mol. Its IUPAC name is 5-[3-[3-(4-butylphenyl)phenyl]-1-cyanocyclohexyl]pentyl prop-2-enoate.
| Compound Name | 5-[3-[3-(4-butylphenyl)phenyl]-1-cyanocyclohexyl]pentyl prop-2-enoate |
|---|---|
| PubChem CID | 67898507 |
| Molecular Formula | C31H39NO2 |
| Molecular Weight | 457.66 g/mol |
| Exact Mass | 457.30 |
| IUPAC Name | 5-[3-[3-(4-butylphenyl)phenyl]-1-cyanocyclohexyl]pentyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCC1(C#N)CCCC(c2cccc(-c3ccc(CCCC)cc3)c2)C1 |
| InChI | InChI=1S/C31H39NO2/c1-3-5-11-25-15-17-26(18-16-25)27-12-9-13-28(22-27)29-14-10-20-31(23-29,24-32)19-7-6-8-21-34-30(33)4-2/h4,9,12-13,15-18,22,29H,2-3,5-8,10-11,14,19-21,23H2,1H3 |
| InChIKey | FAEFTNQIRLZLOB-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.66 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|