C32H41NO2 — CID 20721763
7-[4-[4-(1-isocyano-4-propylcyclohexyl)phenyl]phenyl]heptyl prop-2-enoate (PubChem CID 20721763) has the molecular formula C32H41NO2 and a molecular weight of 471.69 g/mol. Its IUPAC name is 7-[4-[4-(1-isocyano-4-propylcyclohexyl)phenyl]phenyl]heptyl prop-2-enoate.
| Compound Name | 7-[4-[4-(1-isocyano-4-propylcyclohexyl)phenyl]phenyl]heptyl prop-2-enoate |
|---|---|
| PubChem CID | 20721763 |
| Molecular Formula | C32H41NO2 |
| Molecular Weight | 471.69 g/mol |
| Exact Mass | 471.31 |
| IUPAC Name | 7-[4-[4-(1-isocyano-4-propylcyclohexyl)phenyl]phenyl]heptyl prop-2-enoate |
| SMILES | [C-]#[N+]C1(c2ccc(-c3ccc(CCCCCCCOC(=O)C=C)cc3)cc2)CCC(CCC)CC1 |
| InChI | InChI=1S/C32H41NO2/c1-4-11-26-21-23-32(33-3,24-22-26)30-19-17-29(18-20-30)28-15-13-27(14-16-28)12-9-7-6-8-10-25-35-31(34)5-2/h5,13-20,26H,2,4,6-12,21-25H2,1H3 |
| InChIKey | PAJXLEKGHBCWDR-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 30.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.69 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|