C37H43NO5 — CID 134235659
[4-methanimidoyl-4-(4-pentylphenyl)cyclohexyl] 4-[4-(3-prop-2-enoyloxypropoxy)phenyl]benzoate (PubChem CID 134235659) has the molecular formula C37H43NO5 and a molecular weight of 581.75 g/mol. Its IUPAC name is [4-methanimidoyl-4-(4-pentylphenyl)cyclohexyl] 4-[4-(3-prop-2-enoyloxypropoxy)phenyl]benzoate.
| Compound Name | [4-methanimidoyl-4-(4-pentylphenyl)cyclohexyl] 4-[4-(3-prop-2-enoyloxypropoxy)phenyl]benzoate |
|---|---|
| PubChem CID | 134235659 |
| Molecular Formula | C37H43NO5 |
| Molecular Weight | 581.75 g/mol |
| Exact Mass | 581.31 |
| IUPAC Name | [4-methanimidoyl-4-(4-pentylphenyl)cyclohexyl] 4-[4-(3-prop-2-enoyloxypropoxy)phenyl]benzoate |
| SMILES | [H]/N=C/C1(c2ccc(CCCCC)cc2)CCC(OC(=O)c2ccc(-c3ccc(OCCCOC(=O)C=C)cc3)cc2)CC1 |
| InChI | InChI=1S/C37H43NO5/c1-3-5-6-8-28-9-17-32(18-10-28)37(27-38)23-21-34(22-24-37)43-36(40)31-13-11-29(12-14-31)30-15-19-33(20-16-30)41-25-7-26-42-35(39)4-2/h4,9-20,27,34,38H,2-3,5-8,21-26H2,1H3/b38-27+ |
| InChIKey | VFVGUYDBVLKWQG-ACPRRRJJSA-N |
| XLogP | 8.27 |
| TPSA | 85.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.75 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|