C54H64O10 — CID 54429328
[(1R,2R)-2-[4-[4-(8-prop-2-enoyloxyoctoxy)phenyl]benzoyl]oxycyclohexyl] 4-[4-(8-prop-2-enoyloxyoctoxy)phenyl]benzoate (PubChem CID 54429328) has the molecular formula C54H64O10 and a molecular weight of 873.10 g/mol. Its IUPAC name is [(1R,2R)-2-[4-[4-(8-prop-2-enoyloxyoctoxy)phenyl]benzoyl]oxycyclohexyl] 4-[4-(8-prop-2-enoyloxyoctoxy)phenyl]benzoate.
| Compound Name | [(1R,2R)-2-[4-[4-(8-prop-2-enoyloxyoctoxy)phenyl]benzoyl]oxycyclohexyl] 4-[4-(8-prop-2-enoyloxyoctoxy)phenyl]benzoate |
|---|---|
| PubChem CID | 54429328 |
| Molecular Formula | C54H64O10 |
| Molecular Weight | 873.10 g/mol |
| Exact Mass | 872.45 |
| IUPAC Name | [(1R,2R)-2-[4-[4-(8-prop-2-enoyloxyoctoxy)phenyl]benzoyl]oxycyclohexyl] 4-[4-(8-prop-2-enoyloxyoctoxy)phenyl]benzoate |
| SMILES | C=CC(=O)OCCCCCCCCOc1ccc(-c2ccc(C(=O)O[C@@H]3CCCC[C@H]3OC(=O)c3ccc(-c4ccc(OCCCCCCCCOC(=O)C=C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C54H64O10/c1-3-51(55)61-39-17-11-7-5-9-15-37-59-47-33-29-43(30-34-47)41-21-25-45(26-22-41)53(57)63-49-19-13-14-20-50(49)64-54(58)46-27-23-42(24-28-46)44-31-35-48(36-32-44)60-38-16-10-6-8-12-18-40-62-52(56)4-2/h3-4,21-36,49-50H,1-2,5-20,37-40H2/t49-,50-/m1/s1 |
| InChIKey | WGJFGNDNPZLHOT-CDKYPKJRSA-N |
| XLogP | 12.24 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.10 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|