C44H46N2O10 — CID 139713349
[(1R,2R)-2-[6-[4-(4-prop-2-enoyloxybutoxy)phenyl]pyridine-3-carbonyl]oxycyclohexyl] 6-[4-(4-prop-2-enoyloxybutoxy)phenyl]pyridine-3-carboxylate (PubChem CID 139713349) has the molecular formula C44H46N2O10 and a molecular weight of 762.86 g/mol. Its IUPAC name is [(1R,2R)-2-[6-[4-(4-prop-2-enoyloxybutoxy)phenyl]pyridine-3-carbonyl]oxycyclohexyl] 6-[4-(4-prop-2-enoyloxybutoxy)phenyl]pyridine-3-carboxylate.
| Compound Name | [(1R,2R)-2-[6-[4-(4-prop-2-enoyloxybutoxy)phenyl]pyridine-3-carbonyl]oxycyclohexyl] 6-[4-(4-prop-2-enoyloxybutoxy)phenyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 139713349 |
| Molecular Formula | C44H46N2O10 |
| Molecular Weight | 762.86 g/mol |
| Exact Mass | 762.32 |
| IUPAC Name | [(1R,2R)-2-[6-[4-(4-prop-2-enoyloxybutoxy)phenyl]pyridine-3-carbonyl]oxycyclohexyl] 6-[4-(4-prop-2-enoyloxybutoxy)phenyl]pyridine-3-carboxylate |
| SMILES | C=CC(=O)OCCCCOc1ccc(-c2ccc(C(=O)O[C@@H]3CCCC[C@H]3OC(=O)c3ccc(-c4ccc(OCCCCOC(=O)C=C)cc4)nc3)cn2)cc1 |
| InChI | InChI=1S/C44H46N2O10/c1-3-41(47)53-27-9-7-25-51-35-19-13-31(14-20-35)37-23-17-33(29-45-37)43(49)55-39-11-5-6-12-40(39)56-44(50)34-18-24-38(46-30-34)32-15-21-36(22-16-32)52-26-8-10-28-54-42(48)4-2/h3-4,13-24,29-30,39-40H,1-2,5-12,25-28H2/t39-,40-/m1/s1 |
| InChIKey | RLIGNVMECLUNAS-XRSDMRJBSA-N |
| XLogP | 7.91 |
| TPSA | 149.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.86 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|