C48H56N4O12 — CID 70117320
[(2S,3S)-3-[2-[4-(8-prop-2-enoyloxyoctoxy)phenyl]pyrimidine-5-carbonyl]oxy-1,4-dioxan-2-yl] 2-[4-(8-prop-2-enoyloxyoctoxy)phenyl]pyrimidine-5-carboxylate (PubChem CID 70117320) has the molecular formula C48H56N4O12 and a molecular weight of 880.99 g/mol. Its IUPAC name is [(2S,3S)-3-[2-[4-(8-prop-2-enoyloxyoctoxy)phenyl]pyrimidine-5-carbonyl]oxy-1,4-dioxan-2-yl] 2-[4-(8-prop-2-enoyloxyoctoxy)phenyl]pyrimidine-5-carboxylate.
| Compound Name | [(2S,3S)-3-[2-[4-(8-prop-2-enoyloxyoctoxy)phenyl]pyrimidine-5-carbonyl]oxy-1,4-dioxan-2-yl] 2-[4-(8-prop-2-enoyloxyoctoxy)phenyl]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 70117320 |
| Molecular Formula | C48H56N4O12 |
| Molecular Weight | 880.99 g/mol |
| Exact Mass | 880.39 |
| IUPAC Name | [(2S,3S)-3-[2-[4-(8-prop-2-enoyloxyoctoxy)phenyl]pyrimidine-5-carbonyl]oxy-1,4-dioxan-2-yl] 2-[4-(8-prop-2-enoyloxyoctoxy)phenyl]pyrimidine-5-carboxylate |
| SMILES | C=CC(=O)OCCCCCCCCOc1ccc(-c2ncc(C(=O)O[C@@H]3OCCO[C@H]3OC(=O)c3cnc(-c4ccc(OCCCCCCCCOC(=O)C=C)cc4)nc3)cn2)cc1 |
| InChI | InChI=1S/C48H56N4O12/c1-3-41(53)59-27-15-11-7-5-9-13-25-57-39-21-17-35(18-22-39)43-49-31-37(32-50-43)45(55)63-47-48(62-30-29-61-47)64-46(56)38-33-51-44(52-34-38)36-19-23-40(24-20-36)58-26-14-10-6-8-12-16-28-60-42(54)4-2/h3-4,17-24,31-34,47-48H,1-2,5-16,25-30H2/t47-,48-/m0/s1 |
| InChIKey | AIFVZZJGCWKXOG-CRKOEVGVSA-N |
| XLogP | 8.21 |
| TPSA | 193.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.99 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|