C20H24N2O3 — CID 140977152
7-(2-phenylpyrimidin-5-yl)oxyheptyl prop-2-enoate (PubChem CID 140977152) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is 7-(2-phenylpyrimidin-5-yl)oxyheptyl prop-2-enoate.
| Compound Name | 7-(2-phenylpyrimidin-5-yl)oxyheptyl prop-2-enoate |
|---|---|
| PubChem CID | 140977152 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 7-(2-phenylpyrimidin-5-yl)oxyheptyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCCOc1cnc(-c2ccccc2)nc1 |
| InChI | InChI=1S/C20H24N2O3/c1-2-19(23)25-14-10-5-3-4-9-13-24-18-15-21-20(22-16-18)17-11-7-6-8-12-17/h2,6-8,11-12,15-16H,1,3-5,9-10,13-14H2 |
| InChIKey | RJYIEXURXWJTSQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|