C18H25NO5 — CID 59683870
5-(9-prop-2-enoyloxynonoxy)pyridine-2-carboxylic acid (PubChem CID 59683870) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is 5-(9-prop-2-enoyloxynonoxy)pyridine-2-carboxylic acid.
| Compound Name | 5-(9-prop-2-enoyloxynonoxy)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 59683870 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 5-(9-prop-2-enoyloxynonoxy)pyridine-2-carboxylic acid |
| SMILES | C=CC(=O)OCCCCCCCCCOc1ccc(C(=O)O)nc1 |
| InChI | InChI=1S/C18H25NO5/c1-2-17(20)24-13-9-7-5-3-4-6-8-12-23-15-10-11-16(18(21)22)19-14-15/h2,10-11,14H,1,3-9,12-13H2,(H,21,22) |
| InChIKey | XWXOAXILVQBRKC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|