C27H36N2O4 — CID 21461537
7-[2-[4-(cyclohexyloxymethyl)phenyl]pyrimidin-5-yl]oxyheptyl prop-2-enoate (PubChem CID 21461537) has the molecular formula C27H36N2O4 and a molecular weight of 452.60 g/mol. Its IUPAC name is 7-[2-[4-(cyclohexyloxymethyl)phenyl]pyrimidin-5-yl]oxyheptyl prop-2-enoate.
| Compound Name | 7-[2-[4-(cyclohexyloxymethyl)phenyl]pyrimidin-5-yl]oxyheptyl prop-2-enoate |
|---|---|
| PubChem CID | 21461537 |
| Molecular Formula | C27H36N2O4 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | 7-[2-[4-(cyclohexyloxymethyl)phenyl]pyrimidin-5-yl]oxyheptyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCCOc1cnc(-c2ccc(COC3CCCCC3)cc2)nc1 |
| InChI | InChI=1S/C27H36N2O4/c1-2-26(30)32-18-10-5-3-4-9-17-31-25-19-28-27(29-20-25)23-15-13-22(14-16-23)21-33-24-11-7-6-8-12-24/h2,13-16,19-20,24H,1,3-12,17-18,21H2 |
| InChIKey | QNEPPSRWTWHGIM-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|