C23H28N2O4 — CID 21461571
3-[2-[4-(cyclohexyloxymethyl)phenyl]pyrimidin-5-yl]oxypropyl prop-2-enoate (PubChem CID 21461571) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is 3-[2-[4-(cyclohexyloxymethyl)phenyl]pyrimidin-5-yl]oxypropyl prop-2-enoate.
| Compound Name | 3-[2-[4-(cyclohexyloxymethyl)phenyl]pyrimidin-5-yl]oxypropyl prop-2-enoate |
|---|---|
| PubChem CID | 21461571 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 3-[2-[4-(cyclohexyloxymethyl)phenyl]pyrimidin-5-yl]oxypropyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCOc1cnc(-c2ccc(COC3CCCCC3)cc2)nc1 |
| InChI | InChI=1S/C23H28N2O4/c1-2-22(26)28-14-6-13-27-21-15-24-23(25-16-21)19-11-9-18(10-12-19)17-29-20-7-4-3-5-8-20/h2,9-12,15-16,20H,1,3-8,13-14,17H2 |
| InChIKey | MXYRMAWCDKYIFG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|