C46H52N4O10 — CID 54025851
[(1R,2R)-2-[4-[5-(6-prop-2-enoyloxyhexoxy)pyrimidin-2-yl]benzoyl]oxycyclohexyl] 4-[5-(6-prop-2-enoyloxyhexoxy)pyrimidin-2-yl]benzoate (PubChem CID 54025851) has the molecular formula C46H52N4O10 and a molecular weight of 820.94 g/mol. Its IUPAC name is [(1R,2R)-2-[4-[5-(6-prop-2-enoyloxyhexoxy)pyrimidin-2-yl]benzoyl]oxycyclohexyl] 4-[5-(6-prop-2-enoyloxyhexoxy)pyrimidin-2-yl]benzoate.
| Compound Name | [(1R,2R)-2-[4-[5-(6-prop-2-enoyloxyhexoxy)pyrimidin-2-yl]benzoyl]oxycyclohexyl] 4-[5-(6-prop-2-enoyloxyhexoxy)pyrimidin-2-yl]benzoate |
|---|---|
| PubChem CID | 54025851 |
| Molecular Formula | C46H52N4O10 |
| Molecular Weight | 820.94 g/mol |
| Exact Mass | 820.37 |
| IUPAC Name | [(1R,2R)-2-[4-[5-(6-prop-2-enoyloxyhexoxy)pyrimidin-2-yl]benzoyl]oxycyclohexyl] 4-[5-(6-prop-2-enoyloxyhexoxy)pyrimidin-2-yl]benzoate |
| SMILES | C=CC(=O)OCCCCCCOc1cnc(-c2ccc(C(=O)O[C@@H]3CCCC[C@H]3OC(=O)c3ccc(-c4ncc(OCCCCCCOC(=O)C=C)cn4)cc3)cc2)nc1 |
| InChI | InChI=1S/C46H52N4O10/c1-3-41(51)57-27-13-7-5-11-25-55-37-29-47-43(48-30-37)33-17-21-35(22-18-33)45(53)59-39-15-9-10-16-40(39)60-46(54)36-23-19-34(20-24-36)44-49-31-38(32-50-44)56-26-12-6-8-14-28-58-42(52)4-2/h3-4,17-24,29-32,39-40H,1-2,5-16,25-28H2/t39-,40-/m1/s1 |
| InChIKey | LCCSTFUBUGGBLF-XRSDMRJBSA-N |
| XLogP | 8.26 |
| TPSA | 175.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.94 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|