C47H49N5O8 — CID 18979515
6-[2-[4-[[4-cyano-2-[[4-[5-(6-prop-2-enoyloxyhexoxy)pyrimidin-2-yl]phenyl]methoxy]phenoxy]methyl]phenyl]pyrimidin-5-yl]oxyhexyl prop-2-enoate (PubChem CID 18979515) has the molecular formula C47H49N5O8 and a molecular weight of 811.94 g/mol. Its IUPAC name is 6-[2-[4-[[4-cyano-2-[[4-[5-(6-prop-2-enoyloxyhexoxy)pyrimidin-2-yl]phenyl]methoxy]phenoxy]methyl]phenyl]pyrimidin-5-yl]oxyhexyl prop-2-enoate.
| Compound Name | 6-[2-[4-[[4-cyano-2-[[4-[5-(6-prop-2-enoyloxyhexoxy)pyrimidin-2-yl]phenyl]methoxy]phenoxy]methyl]phenyl]pyrimidin-5-yl]oxyhexyl prop-2-enoate |
|---|---|
| PubChem CID | 18979515 |
| Molecular Formula | C47H49N5O8 |
| Molecular Weight | 811.94 g/mol |
| Exact Mass | 811.36 |
| IUPAC Name | 6-[2-[4-[[4-cyano-2-[[4-[5-(6-prop-2-enoyloxyhexoxy)pyrimidin-2-yl]phenyl]methoxy]phenoxy]methyl]phenyl]pyrimidin-5-yl]oxyhexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1cnc(-c2ccc(COc3ccc(C#N)cc3OCc3ccc(-c4ncc(OCCCCCCOC(=O)C=C)cn4)cc3)cc2)nc1 |
| InChI | InChI=1S/C47H49N5O8/c1-3-44(53)57-25-11-7-5-9-23-55-40-29-49-46(50-30-40)38-18-13-35(14-19-38)33-59-42-22-17-37(28-48)27-43(42)60-34-36-15-20-39(21-16-36)47-51-31-41(32-52-47)56-24-10-6-8-12-26-58-45(54)4-2/h3-4,13-22,27,29-32H,1-2,5-12,23-26,33-34H2 |
| InChIKey | PMUVHLJGBRCAKA-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 164.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.94 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|