C32H35NO4 — CID 22445810
9-[4-[4-[(2-cyanophenoxy)methyl]phenyl]phenoxy]nonyl prop-2-enoate (PubChem CID 22445810) has the molecular formula C32H35NO4 and a molecular weight of 497.64 g/mol. Its IUPAC name is 9-[4-[4-[(2-cyanophenoxy)methyl]phenyl]phenoxy]nonyl prop-2-enoate.
| Compound Name | 9-[4-[4-[(2-cyanophenoxy)methyl]phenyl]phenoxy]nonyl prop-2-enoate |
|---|---|
| PubChem CID | 22445810 |
| Molecular Formula | C32H35NO4 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | 9-[4-[4-[(2-cyanophenoxy)methyl]phenyl]phenoxy]nonyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCCCCOc1ccc(-c2ccc(COc3ccccc3C#N)cc2)cc1 |
| InChI | InChI=1S/C32H35NO4/c1-2-32(34)36-23-11-7-5-3-4-6-10-22-35-30-20-18-28(19-21-30)27-16-14-26(15-17-27)25-37-31-13-9-8-12-29(31)24-33/h2,8-9,12-21H,1,3-7,10-11,22-23,25H2 |
| InChIKey | IBFFDSQFQQBCBU-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|