C28H25NO5 — CID 22445802
(2-cyanophenyl) 4-[4-(5-prop-2-enoyloxypentoxy)phenyl]benzoate (PubChem CID 22445802) has the molecular formula C28H25NO5 and a molecular weight of 455.51 g/mol. Its IUPAC name is (2-cyanophenyl) 4-[4-(5-prop-2-enoyloxypentoxy)phenyl]benzoate.
| Compound Name | (2-cyanophenyl) 4-[4-(5-prop-2-enoyloxypentoxy)phenyl]benzoate |
|---|---|
| PubChem CID | 22445802 |
| Molecular Formula | C28H25NO5 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | (2-cyanophenyl) 4-[4-(5-prop-2-enoyloxypentoxy)phenyl]benzoate |
| SMILES | C=CC(=O)OCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccccc3C#N)cc2)cc1 |
| InChI | InChI=1S/C28H25NO5/c1-2-27(30)33-19-7-3-6-18-32-25-16-14-22(15-17-25)21-10-12-23(13-11-21)28(31)34-26-9-5-4-8-24(26)20-29/h2,4-5,8-17H,1,3,6-7,18-19H2 |
| InChIKey | QZLMRWHODGOHBG-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|