C36H44N2O6 — CID 59938703
6-[4-[1-[2-[4-(6-prop-2-enylperoxyhexoxy)phenyl]pyrimidin-5-yl]ethenyl]phenoxy]hexyl prop-2-enoate (PubChem CID 59938703) has the molecular formula C36H44N2O6 and a molecular weight of 600.76 g/mol. Its IUPAC name is 6-[4-[1-[2-[4-(6-prop-2-enylperoxyhexoxy)phenyl]pyrimidin-5-yl]ethenyl]phenoxy]hexyl prop-2-enoate.
| Compound Name | 6-[4-[1-[2-[4-(6-prop-2-enylperoxyhexoxy)phenyl]pyrimidin-5-yl]ethenyl]phenoxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 59938703 |
| Molecular Formula | C36H44N2O6 |
| Molecular Weight | 600.76 g/mol |
| Exact Mass | 600.32 |
| IUPAC Name | 6-[4-[1-[2-[4-(6-prop-2-enylperoxyhexoxy)phenyl]pyrimidin-5-yl]ethenyl]phenoxy]hexyl prop-2-enoate |
| SMILES | C=CCOOCCCCCCOc1ccc(-c2ncc(C(=C)c3ccc(OCCCCCCOC(=O)C=C)cc3)cn2)cc1 |
| InChI | InChI=1S/C36H44N2O6/c1-4-22-43-44-26-13-9-8-11-24-41-34-20-16-31(17-21-34)36-37-27-32(28-38-36)29(3)30-14-18-33(19-15-30)40-23-10-6-7-12-25-42-35(39)5-2/h4-5,14-21,27-28H,1-3,6-13,22-26H2 |
| InChIKey | KKAFTPSJCUEQED-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 89.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.76 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|