C38H46O10 — CID 20586860
[4-[[4-(6-prop-2-enylperoxyhexoxy)phenyl]methylperoxy]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate (PubChem CID 20586860) has the molecular formula C38H46O10 and a molecular weight of 662.78 g/mol. Its IUPAC name is [4-[[4-(6-prop-2-enylperoxyhexoxy)phenyl]methylperoxy]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate.
| Compound Name | [4-[[4-(6-prop-2-enylperoxyhexoxy)phenyl]methylperoxy]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
|---|---|
| PubChem CID | 20586860 |
| Molecular Formula | C38H46O10 |
| Molecular Weight | 662.78 g/mol |
| Exact Mass | 662.31 |
| IUPAC Name | [4-[[4-(6-prop-2-enylperoxyhexoxy)phenyl]methylperoxy]phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
| SMILES | C=CCOOCCCCCCOc1ccc(COOc2ccc(OC(=O)c3ccc(OCCCCCCOC(=O)C=C)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H46O10/c1-3-25-44-45-29-12-8-7-10-26-41-33-17-13-31(14-18-33)30-46-48-36-23-21-35(22-24-36)47-38(40)32-15-19-34(20-16-32)42-27-9-5-6-11-28-43-37(39)4-2/h3-4,13-24H,1-2,5-12,25-30H2 |
| InChIKey | UQLINPVVTIRXIT-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.78 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|