C34H41FO6 — CID 54012328
6-[6-[2-fluoro-4-(6-prop-2-enylperoxyhexoxy)phenyl]naphthalen-2-yl]oxyhexyl prop-2-enoate (PubChem CID 54012328) has the molecular formula C34H41FO6 and a molecular weight of 564.69 g/mol. Its IUPAC name is 6-[6-[2-fluoro-4-(6-prop-2-enylperoxyhexoxy)phenyl]naphthalen-2-yl]oxyhexyl prop-2-enoate.
| Compound Name | 6-[6-[2-fluoro-4-(6-prop-2-enylperoxyhexoxy)phenyl]naphthalen-2-yl]oxyhexyl prop-2-enoate |
|---|---|
| PubChem CID | 54012328 |
| Molecular Formula | C34H41FO6 |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.29 |
| IUPAC Name | 6-[6-[2-fluoro-4-(6-prop-2-enylperoxyhexoxy)phenyl]naphthalen-2-yl]oxyhexyl prop-2-enoate |
| SMILES | C=CCOOCCCCCCOc1ccc(-c2ccc3cc(OCCCCCCOC(=O)C=C)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C34H41FO6/c1-3-19-40-41-23-12-8-7-10-21-38-31-17-18-32(33(35)26-31)29-14-13-28-25-30(16-15-27(28)24-29)37-20-9-5-6-11-22-39-34(36)4-2/h3-4,13-18,24-26H,1-2,5-12,19-23H2 |
| InChIKey | KTFJRGFTGHMGNI-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|