C28H29FO6 — CID 54164163
3-[6-[2-fluoro-4-(3-prop-2-enylperoxypropoxy)phenyl]naphthalen-2-yl]oxypropyl prop-2-enoate (PubChem CID 54164163) has the molecular formula C28H29FO6 and a molecular weight of 480.53 g/mol. Its IUPAC name is 3-[6-[2-fluoro-4-(3-prop-2-enylperoxypropoxy)phenyl]naphthalen-2-yl]oxypropyl prop-2-enoate.
| Compound Name | 3-[6-[2-fluoro-4-(3-prop-2-enylperoxypropoxy)phenyl]naphthalen-2-yl]oxypropyl prop-2-enoate |
|---|---|
| PubChem CID | 54164163 |
| Molecular Formula | C28H29FO6 |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | 3-[6-[2-fluoro-4-(3-prop-2-enylperoxypropoxy)phenyl]naphthalen-2-yl]oxypropyl prop-2-enoate |
| SMILES | C=CCOOCCCOc1ccc(-c2ccc3cc(OCCCOC(=O)C=C)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C28H29FO6/c1-3-13-34-35-17-6-15-32-25-11-12-26(27(29)20-25)23-8-7-22-19-24(10-9-21(22)18-23)31-14-5-16-33-28(30)4-2/h3-4,7-12,18-20H,1-2,5-6,13-17H2 |
| InChIKey | OQMKRXDYDADXJZ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|