C40H37FO6 — CID 145389582
3-[4-[2-fluoro-4-[4-[6-[(E)-hex-4-enoxy]naphthalen-2-yl]phenyl]phenyl]peroxyphenoxy]propyl prop-2-enoate (PubChem CID 145389582) has the molecular formula C40H37FO6 and a molecular weight of 632.73 g/mol. Its IUPAC name is 3-[4-[2-fluoro-4-[4-[6-[(E)-hex-4-enoxy]naphthalen-2-yl]phenyl]phenyl]peroxyphenoxy]propyl prop-2-enoate.
| Compound Name | 3-[4-[2-fluoro-4-[4-[6-[(E)-hex-4-enoxy]naphthalen-2-yl]phenyl]phenyl]peroxyphenoxy]propyl prop-2-enoate |
|---|---|
| PubChem CID | 145389582 |
| Molecular Formula | C40H37FO6 |
| Molecular Weight | 632.73 g/mol |
| Exact Mass | 632.26 |
| IUPAC Name | 3-[4-[2-fluoro-4-[4-[6-[(E)-hex-4-enoxy]naphthalen-2-yl]phenyl]phenyl]peroxyphenoxy]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCOc1ccc(OOc2ccc(-c3ccc(-c4ccc5cc(OCCC/C=C/C)ccc5c4)cc3)cc2F)cc1 |
| InChI | InChI=1S/C40H37FO6/c1-3-5-6-7-23-44-37-17-15-32-26-31(13-14-33(32)27-37)29-9-11-30(12-10-29)34-16-22-39(38(41)28-34)47-46-36-20-18-35(19-21-36)43-24-8-25-45-40(42)4-2/h3-5,9-22,26-28H,2,6-8,23-25H2,1H3/b5-3+ |
| InChIKey | YTVSFIIGBCOEGJ-HWKANZROSA-N |
| XLogP | 9.92 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.73 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|