C42H40O12 — CID 70120219
[(2S,3S)-3-[4-[4-(3-prop-2-enoyloxypropoxy)phenyl]benzoyl]oxy-1,4-dioxan-2-yl] 4-[4-(3-prop-2-enoyloxypropoxy)phenyl]benzoate (PubChem CID 70120219) has the molecular formula C42H40O12 and a molecular weight of 736.77 g/mol. Its IUPAC name is [(2S,3S)-3-[4-[4-(3-prop-2-enoyloxypropoxy)phenyl]benzoyl]oxy-1,4-dioxan-2-yl] 4-[4-(3-prop-2-enoyloxypropoxy)phenyl]benzoate.
| Compound Name | [(2S,3S)-3-[4-[4-(3-prop-2-enoyloxypropoxy)phenyl]benzoyl]oxy-1,4-dioxan-2-yl] 4-[4-(3-prop-2-enoyloxypropoxy)phenyl]benzoate |
|---|---|
| PubChem CID | 70120219 |
| Molecular Formula | C42H40O12 |
| Molecular Weight | 736.77 g/mol |
| Exact Mass | 736.25 |
| IUPAC Name | [(2S,3S)-3-[4-[4-(3-prop-2-enoyloxypropoxy)phenyl]benzoyl]oxy-1,4-dioxan-2-yl] 4-[4-(3-prop-2-enoyloxypropoxy)phenyl]benzoate |
| SMILES | C=CC(=O)OCCCOc1ccc(-c2ccc(C(=O)O[C@@H]3OCCO[C@H]3OC(=O)c3ccc(-c4ccc(OCCCOC(=O)C=C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C42H40O12/c1-3-37(43)49-25-5-23-47-35-19-15-31(16-20-35)29-7-11-33(12-8-29)39(45)53-41-42(52-28-27-51-41)54-40(46)34-13-9-30(10-14-34)32-17-21-36(22-18-32)48-24-6-26-50-38(44)4-2/h3-4,7-22,41-42H,1-2,5-6,23-28H2/t41-,42-/m0/s1 |
| InChIKey | MRLYCPIGXZEDOQ-COCZKOEFSA-N |
| XLogP | 6.73 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.77 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|