C37H44O8 — CID 90265971
(4-nonylphenyl) 3-methoxy-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxybenzoate (PubChem CID 90265971) has the molecular formula C37H44O8 and a molecular weight of 616.75 g/mol. Its IUPAC name is (4-nonylphenyl) 3-methoxy-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxybenzoate.
| Compound Name | (4-nonylphenyl) 3-methoxy-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxybenzoate |
|---|---|
| PubChem CID | 90265971 |
| Molecular Formula | C37H44O8 |
| Molecular Weight | 616.75 g/mol |
| Exact Mass | 616.30 |
| IUPAC Name | (4-nonylphenyl) 3-methoxy-4-[4-(4-prop-2-enoyloxybutoxy)benzoyl]oxybenzoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(CCCCCCCCC)cc3)cc2OC)cc1 |
| InChI | InChI=1S/C37H44O8/c1-4-6-7-8-9-10-11-14-28-15-20-32(21-16-28)44-37(40)30-19-24-33(34(27-30)41-3)45-36(39)29-17-22-31(23-18-29)42-25-12-13-26-43-35(38)5-2/h5,15-24,27H,2,4,6-14,25-26H2,1,3H3 |
| InChIKey | UUKIMOXRCSKMCS-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.75 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|