C28H26O8 — CID 90268492
[4-(4-ethylphenoxy)carbonylphenyl] 3-methoxy-4-(2-prop-2-enoyloxyethoxy)benzoate (PubChem CID 90268492) has the molecular formula C28H26O8 and a molecular weight of 490.51 g/mol. Its IUPAC name is [4-(4-ethylphenoxy)carbonylphenyl] 3-methoxy-4-(2-prop-2-enoyloxyethoxy)benzoate.
| Compound Name | [4-(4-ethylphenoxy)carbonylphenyl] 3-methoxy-4-(2-prop-2-enoyloxyethoxy)benzoate |
|---|---|
| PubChem CID | 90268492 |
| Molecular Formula | C28H26O8 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | [4-(4-ethylphenoxy)carbonylphenyl] 3-methoxy-4-(2-prop-2-enoyloxyethoxy)benzoate |
| SMILES | C=CC(=O)OCCOc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(CC)cc3)cc2)cc1OC |
| InChI | InChI=1S/C28H26O8/c1-4-19-6-11-22(12-7-19)35-27(30)20-8-13-23(14-9-20)36-28(31)21-10-15-24(25(18-21)32-3)33-16-17-34-26(29)5-2/h5-15,18H,2,4,16-17H2,1,3H3 |
| InChIKey | MYOWJWWNPSAYQU-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|