C38H58O8 — CID 89075363
[1-[2-[1-(6-prop-2-enoyloxyhexanoyloxy)-4-propylcyclohexyl]ethynyl]-4-propylcyclohexyl] 6-prop-2-enoyloxyhexanoate (PubChem CID 89075363) has the molecular formula C38H58O8 and a molecular weight of 642.87 g/mol. Its IUPAC name is [1-[2-[1-(6-prop-2-enoyloxyhexanoyloxy)-4-propylcyclohexyl]ethynyl]-4-propylcyclohexyl] 6-prop-2-enoyloxyhexanoate.
| Compound Name | [1-[2-[1-(6-prop-2-enoyloxyhexanoyloxy)-4-propylcyclohexyl]ethynyl]-4-propylcyclohexyl] 6-prop-2-enoyloxyhexanoate |
|---|---|
| PubChem CID | 89075363 |
| Molecular Formula | C38H58O8 |
| Molecular Weight | 642.87 g/mol |
| Exact Mass | 642.41 |
| IUPAC Name | [1-[2-[1-(6-prop-2-enoyloxyhexanoyloxy)-4-propylcyclohexyl]ethynyl]-4-propylcyclohexyl] 6-prop-2-enoyloxyhexanoate |
| SMILES | C=CC(=O)OCCCCCC(=O)OC1(C#CC2(OC(=O)CCCCCOC(=O)C=C)CCC(CCC)CC2)CCC(CCC)CC1 |
| InChI | InChI=1S/C38H58O8/c1-5-15-31-19-23-37(24-20-31,45-35(41)17-11-9-13-29-43-33(39)7-3)27-28-38(25-21-32(16-6-2)22-26-38)46-36(42)18-12-10-14-30-44-34(40)8-4/h7-8,31-32H,3-6,9-26,29-30H2,1-2H3 |
| InChIKey | OCBGLCCDOFEZEN-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.87 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|