C30H44O8 — CID 129190096
3-[1-[(5S)-5-methyl-5-(3-prop-2-enoyloxypropylperoxy)octa-1,3-diynyl]-4-propylcyclohexyl]peroxypropyl prop-2-enoate (PubChem CID 129190096) has the molecular formula C30H44O8 and a molecular weight of 532.67 g/mol. Its IUPAC name is 3-[1-[(5S)-5-methyl-5-(3-prop-2-enoyloxypropylperoxy)octa-1,3-diynyl]-4-propylcyclohexyl]peroxypropyl prop-2-enoate.
| Compound Name | 3-[1-[(5S)-5-methyl-5-(3-prop-2-enoyloxypropylperoxy)octa-1,3-diynyl]-4-propylcyclohexyl]peroxypropyl prop-2-enoate |
|---|---|
| PubChem CID | 129190096 |
| Molecular Formula | C30H44O8 |
| Molecular Weight | 532.67 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | 3-[1-[(5S)-5-methyl-5-(3-prop-2-enoyloxypropylperoxy)octa-1,3-diynyl]-4-propylcyclohexyl]peroxypropyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCOOC1(C#CC#C[C@](C)(CCC)OOCCCOC(=O)C=C)CCC(CCC)CC1 |
| InChI | InChI=1S/C30H44O8/c1-6-14-26-15-20-30(21-16-26,38-36-25-13-23-34-28(32)9-4)19-11-10-18-29(5,17-7-2)37-35-24-12-22-33-27(31)8-3/h8-9,26H,3-4,6-7,12-17,20-25H2,1-2,5H3/t26?,29-,30?/m0/s1 |
| InChIKey | NAZQFSLSVWAOIO-KCWZCOQTSA-N |
| XLogP | 5.42 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.67 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|