C50H78O6 — CID 89069472
4-[1-[4-[1-(4-prop-2-enoyloxybutoxy)-4-(4-propylcyclohexyl)cyclohexyl]phenyl]-4-(4-propylcyclohexyl)cyclohexyl]oxybutyl prop-2-enoate (PubChem CID 89069472) has the molecular formula C50H78O6 and a molecular weight of 775.17 g/mol. Its IUPAC name is 4-[1-[4-[1-(4-prop-2-enoyloxybutoxy)-4-(4-propylcyclohexyl)cyclohexyl]phenyl]-4-(4-propylcyclohexyl)cyclohexyl]oxybutyl prop-2-enoate.
| Compound Name | 4-[1-[4-[1-(4-prop-2-enoyloxybutoxy)-4-(4-propylcyclohexyl)cyclohexyl]phenyl]-4-(4-propylcyclohexyl)cyclohexyl]oxybutyl prop-2-enoate |
|---|---|
| PubChem CID | 89069472 |
| Molecular Formula | C50H78O6 |
| Molecular Weight | 775.17 g/mol |
| Exact Mass | 774.58 |
| IUPAC Name | 4-[1-[4-[1-(4-prop-2-enoyloxybutoxy)-4-(4-propylcyclohexyl)cyclohexyl]phenyl]-4-(4-propylcyclohexyl)cyclohexyl]oxybutyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCOC1(c2ccc(C3(OCCCCOC(=O)C=C)CCC(C4CCC(CCC)CC4)CC3)cc2)CCC(C2CCC(CCC)CC2)CC1 |
| InChI | InChI=1S/C50H78O6/c1-5-13-39-15-19-41(20-16-39)43-27-31-49(32-28-43,55-37-11-9-35-53-47(51)7-3)45-23-25-46(26-24-45)50(56-38-12-10-36-54-48(52)8-4)33-29-44(30-34-50)42-21-17-40(14-6-2)18-22-42/h7-8,23-26,39-44H,3-6,9-22,27-38H2,1-2H3 |
| InChIKey | MVBRTAPMBBNJIZ-UHFFFAOYSA-N |
| XLogP | 12.72 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.17 |
| LogP ≤ 5 | 12.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|