C33H52O5 — CID 59309314
3-[1-[2-[1-(3-buta-1,3-dien-2-yloxypropoxy)-4-propylcyclohexyl]ethynyl]-4-propylcyclohexyl]oxypropyl prop-2-enoate (PubChem CID 59309314) has the molecular formula C33H52O5 and a molecular weight of 528.77 g/mol. Its IUPAC name is 3-[1-[2-[1-(3-buta-1,3-dien-2-yloxypropoxy)-4-propylcyclohexyl]ethynyl]-4-propylcyclohexyl]oxypropyl prop-2-enoate.
| Compound Name | 3-[1-[2-[1-(3-buta-1,3-dien-2-yloxypropoxy)-4-propylcyclohexyl]ethynyl]-4-propylcyclohexyl]oxypropyl prop-2-enoate |
|---|---|
| PubChem CID | 59309314 |
| Molecular Formula | C33H52O5 |
| Molecular Weight | 528.77 g/mol |
| Exact Mass | 528.38 |
| IUPAC Name | 3-[1-[2-[1-(3-buta-1,3-dien-2-yloxypropoxy)-4-propylcyclohexyl]ethynyl]-4-propylcyclohexyl]oxypropyl prop-2-enoate |
| SMILES | C=CC(=C)OCCCOC1(C#CC2(OCCCOC(=O)C=C)CCC(CCC)CC2)CCC(CCC)CC1 |
| InChI | InChI=1S/C33H52O5/c1-6-12-29-14-18-32(19-15-29,37-26-10-24-35-28(5)8-3)22-23-33(20-16-30(13-7-2)17-21-33)38-27-11-25-36-31(34)9-4/h8-9,29-30H,3-7,10-21,24-27H2,1-2H3 |
| InChIKey | NTWNAGYABSTLAS-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.77 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|