C19H32O3 — CID 146666204
2-[1-(2-prop-2-enoxyethyl)-4-propylcyclohexyl]ethyl prop-2-enoate (PubChem CID 146666204) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is 2-[1-(2-prop-2-enoxyethyl)-4-propylcyclohexyl]ethyl prop-2-enoate.
| Compound Name | 2-[1-(2-prop-2-enoxyethyl)-4-propylcyclohexyl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 146666204 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | 2-[1-(2-prop-2-enoxyethyl)-4-propylcyclohexyl]ethyl prop-2-enoate |
| SMILES | C=CCOCCC1(CCOC(=O)C=C)CCC(CCC)CC1 |
| InChI | InChI=1S/C19H32O3/c1-4-7-17-8-10-19(11-9-17,12-15-21-14-5-2)13-16-22-18(20)6-3/h5-6,17H,2-4,7-16H2,1H3 |
| InChIKey | NDSWDKRJVSYLPP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|