C39H60O7 — CID 89233543
[1-[2-[1-(6-prop-2-enoyloxyhexanoyloxy)-4-propylcyclohexyl]ethynyl]-4-propylcyclohexyl] 6-buta-1,3-dien-2-yloxyhexanoate (PubChem CID 89233543) has the molecular formula C39H60O7 and a molecular weight of 640.90 g/mol. Its IUPAC name is [1-[2-[1-(6-prop-2-enoyloxyhexanoyloxy)-4-propylcyclohexyl]ethynyl]-4-propylcyclohexyl] 6-buta-1,3-dien-2-yloxyhexanoate.
| Compound Name | [1-[2-[1-(6-prop-2-enoyloxyhexanoyloxy)-4-propylcyclohexyl]ethynyl]-4-propylcyclohexyl] 6-buta-1,3-dien-2-yloxyhexanoate |
|---|---|
| PubChem CID | 89233543 |
| Molecular Formula | C39H60O7 |
| Molecular Weight | 640.90 g/mol |
| Exact Mass | 640.43 |
| IUPAC Name | [1-[2-[1-(6-prop-2-enoyloxyhexanoyloxy)-4-propylcyclohexyl]ethynyl]-4-propylcyclohexyl] 6-buta-1,3-dien-2-yloxyhexanoate |
| SMILES | C=CC(=C)OCCCCCC(=O)OC1(C#CC2(OC(=O)CCCCCOC(=O)C=C)CCC(CCC)CC2)CCC(CCC)CC1 |
| InChI | InChI=1S/C39H60O7/c1-6-16-33-20-24-38(25-21-33,45-36(41)18-12-10-14-30-43-32(5)8-3)28-29-39(26-22-34(17-7-2)23-27-39)46-37(42)19-13-11-15-31-44-35(40)9-4/h8-9,33-34H,3-7,10-27,30-31H2,1-2H3 |
| InChIKey | WTEWMYSAFCCKKN-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.90 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|