C20H30O2 — CID 59475452
[1-ethynyl-4-(4-propylcyclohexyl)cyclohexyl] prop-2-enoate (PubChem CID 59475452) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is [1-ethynyl-4-(4-propylcyclohexyl)cyclohexyl] prop-2-enoate.
| Compound Name | [1-ethynyl-4-(4-propylcyclohexyl)cyclohexyl] prop-2-enoate |
|---|---|
| PubChem CID | 59475452 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | [1-ethynyl-4-(4-propylcyclohexyl)cyclohexyl] prop-2-enoate |
| SMILES | C#CC1(OC(=O)C=C)CCC(C2CCC(CCC)CC2)CC1 |
| InChI | InChI=1S/C20H30O2/c1-4-7-16-8-10-17(11-9-16)18-12-14-20(6-3,15-13-18)22-19(21)5-2/h3,5,16-18H,2,4,7-15H2,1H3 |
| InChIKey | OWGJHJMBFYUVQR-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|