C17H28O — CID 18364504
1-ethynyl-4-(4-propylcyclohexyl)cyclohexan-1-ol (PubChem CID 18364504) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is 1-ethynyl-4-(4-propylcyclohexyl)cyclohexan-1-ol.
| Compound Name | 1-ethynyl-4-(4-propylcyclohexyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 18364504 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | 1-ethynyl-4-(4-propylcyclohexyl)cyclohexan-1-ol |
| SMILES | C#CC1(O)CCC(C2CCC(CCC)CC2)CC1 |
| InChI | InChI=1S/C17H28O/c1-3-5-14-6-8-15(9-7-14)16-10-12-17(18,4-2)13-11-16/h2,14-16,18H,3,5-13H2,1H3 |
| InChIKey | YLANWHAONKYIAY-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|