C36H51NO3 — CID 19979975
(4-cyano-4-heptylcyclohexyl) 4-(4-nonoxyphenyl)benzoate (PubChem CID 19979975) has the molecular formula C36H51NO3 and a molecular weight of 545.81 g/mol. Its IUPAC name is (4-cyano-4-heptylcyclohexyl) 4-(4-nonoxyphenyl)benzoate.
| Compound Name | (4-cyano-4-heptylcyclohexyl) 4-(4-nonoxyphenyl)benzoate |
|---|---|
| PubChem CID | 19979975 |
| Molecular Formula | C36H51NO3 |
| Molecular Weight | 545.81 g/mol |
| Exact Mass | 545.39 |
| IUPAC Name | (4-cyano-4-heptylcyclohexyl) 4-(4-nonoxyphenyl)benzoate |
| SMILES | CCCCCCCCCOc1ccc(-c2ccc(C(=O)OC3CCC(C#N)(CCCCCCC)CC3)cc2)cc1 |
| InChI | InChI=1S/C36H51NO3/c1-3-5-7-9-10-12-14-28-39-33-21-19-31(20-22-33)30-15-17-32(18-16-30)35(38)40-34-23-26-36(29-37,27-24-34)25-13-11-8-6-4-2/h15-22,34H,3-14,23-28H2,1-2H3 |
| InChIKey | YABBKMRRSZHNCB-UHFFFAOYSA-N |
| XLogP | 10.45 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.81 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|