C28H43NO3 — CID 57307743
4-cyano-1-(4-heptoxyphenyl)-4-heptylcyclohexane-1-carboxylic acid (PubChem CID 57307743) has the molecular formula C28H43NO3 and a molecular weight of 441.66 g/mol. Its IUPAC name is 4-cyano-1-(4-heptoxyphenyl)-4-heptylcyclohexane-1-carboxylic acid.
| Compound Name | 4-cyano-1-(4-heptoxyphenyl)-4-heptylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 57307743 |
| Molecular Formula | C28H43NO3 |
| Molecular Weight | 441.66 g/mol |
| Exact Mass | 441.32 |
| IUPAC Name | 4-cyano-1-(4-heptoxyphenyl)-4-heptylcyclohexane-1-carboxylic acid |
| SMILES | CCCCCCCOc1ccc(C2(C(=O)O)CCC(C#N)(CCCCCCC)CC2)cc1 |
| InChI | InChI=1S/C28H43NO3/c1-3-5-7-9-11-17-27(23-29)18-20-28(21-19-27,26(30)31)24-13-15-25(16-14-24)32-22-12-10-8-6-4-2/h13-16H,3-12,17-22H2,1-2H3,(H,30,31) |
| InChIKey | PTGPKRFMQQUWSV-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.66 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|