C19H25NO2 — CID 70441856
2-(4-cyano-4-pentylcyclohexyl)benzoic acid (PubChem CID 70441856) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is 2-(4-cyano-4-pentylcyclohexyl)benzoic acid.
| Compound Name | 2-(4-cyano-4-pentylcyclohexyl)benzoic acid |
|---|---|
| PubChem CID | 70441856 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | 2-(4-cyano-4-pentylcyclohexyl)benzoic acid |
| SMILES | CCCCCC1(C#N)CCC(c2ccccc2C(=O)O)CC1 |
| InChI | InChI=1S/C19H25NO2/c1-2-3-6-11-19(14-20)12-9-15(10-13-19)16-7-4-5-8-17(16)18(21)22/h4-5,7-8,15H,2-3,6,9-13H2,1H3,(H,21,22) |
| InChIKey | OQQIBVFWPQPZPO-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|