C26H36O4 — CID 175156296
2-(4-pentylcyclohexyl)benzoic acid;1-phenylethane-1,1-diol (PubChem CID 175156296) has the molecular formula C26H36O4 and a molecular weight of 412.57 g/mol. Its IUPAC name is 2-(4-pentylcyclohexyl)benzoic acid;1-phenylethane-1,1-diol.
| Compound Name | 2-(4-pentylcyclohexyl)benzoic acid;1-phenylethane-1,1-diol |
|---|---|
| PubChem CID | 175156296 |
| Molecular Formula | C26H36O4 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 2-(4-pentylcyclohexyl)benzoic acid;1-phenylethane-1,1-diol |
| SMILES | CC(O)(O)c1ccccc1.CCCCCC1CCC(c2ccccc2C(=O)O)CC1 |
| InChI | InChI=1S/C18H26O2.C8H10O2/c1-2-3-4-7-14-10-12-15(13-11-14)16-8-5-6-9-17(16)18(19)20;1-8(9,10)7-5-3-2-4-6-7/h5-6,8-9,14-15H,2-4,7,10-13H2,1H3,(H,19,20);2-6,9-10H,1H3 |
| InChIKey | OTIRYTIHARBBMW-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|