C27H36O2 — CID 67854018
2-(4-pentylcyclohexyl)-3-(4-propylphenyl)benzoic acid (PubChem CID 67854018) has the molecular formula C27H36O2 and a molecular weight of 392.58 g/mol. Its IUPAC name is 2-(4-pentylcyclohexyl)-3-(4-propylphenyl)benzoic acid.
| Compound Name | 2-(4-pentylcyclohexyl)-3-(4-propylphenyl)benzoic acid |
|---|---|
| PubChem CID | 67854018 |
| Molecular Formula | C27H36O2 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | 2-(4-pentylcyclohexyl)-3-(4-propylphenyl)benzoic acid |
| SMILES | CCCCCC1CCC(c2c(C(=O)O)cccc2-c2ccc(CCC)cc2)CC1 |
| InChI | InChI=1S/C27H36O2/c1-3-5-6-9-21-14-18-23(19-15-21)26-24(10-7-11-25(26)27(28)29)22-16-12-20(8-4-2)13-17-22/h7,10-13,16-17,21,23H,3-6,8-9,14-15,18-19H2,1-2H3,(H,28,29) |
| InChIKey | BPHOFQNCINJOFQ-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|