C17H22BrN — CID 18650665
4-(4-bromophenyl)-1-butylcyclohexane-1-carbonitrile (PubChem CID 18650665) has the molecular formula C17H22BrN and a molecular weight of 320.27 g/mol. Its IUPAC name is 4-(4-bromophenyl)-1-butylcyclohexane-1-carbonitrile.
| Compound Name | 4-(4-bromophenyl)-1-butylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 18650665 |
| Molecular Formula | C17H22BrN |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 4-(4-bromophenyl)-1-butylcyclohexane-1-carbonitrile |
| SMILES | CCCCC1(C#N)CCC(c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C17H22BrN/c1-2-3-10-17(13-19)11-8-15(9-12-17)14-4-6-16(18)7-5-14/h4-7,15H,2-3,8-12H2,1H3 |
| InChIKey | UDTOIIRZBRMALB-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |