C24H35NO3 — CID 19819454
(4-cyano-4-hexylcyclohexyl) 4-butoxybenzoate (PubChem CID 19819454) has the molecular formula C24H35NO3 and a molecular weight of 385.55 g/mol. Its IUPAC name is (4-cyano-4-hexylcyclohexyl) 4-butoxybenzoate.
| Compound Name | (4-cyano-4-hexylcyclohexyl) 4-butoxybenzoate |
|---|---|
| PubChem CID | 19819454 |
| Molecular Formula | C24H35NO3 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | (4-cyano-4-hexylcyclohexyl) 4-butoxybenzoate |
| SMILES | CCCCCCC1(C#N)CCC(OC(=O)c2ccc(OCCCC)cc2)CC1 |
| InChI | InChI=1S/C24H35NO3/c1-3-5-7-8-15-24(19-25)16-13-22(14-17-24)28-23(26)20-9-11-21(12-10-20)27-18-6-4-2/h9-12,22H,3-8,13-18H2,1-2H3 |
| InChIKey | JURRSZJZLNPOCN-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|