C25H35NO2 — CID 615297
(4-cyano-4-ethylcyclohexyl) 4-(4-propylcyclohexyl)benzoate (PubChem CID 615297) has the molecular formula C25H35NO2 and a molecular weight of 381.56 g/mol. Its IUPAC name is (4-cyano-4-ethylcyclohexyl) 4-(4-propylcyclohexyl)benzoate.
| Compound Name | (4-cyano-4-ethylcyclohexyl) 4-(4-propylcyclohexyl)benzoate |
|---|---|
| PubChem CID | 615297 |
| Molecular Formula | C25H35NO2 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | (4-cyano-4-ethylcyclohexyl) 4-(4-propylcyclohexyl)benzoate |
| SMILES | CCCC1CCC(c2ccc(C(=O)OC3CCC(C#N)(CC)CC3)cc2)CC1 |
| InChI | InChI=1S/C25H35NO2/c1-3-5-19-6-8-20(9-7-19)21-10-12-22(13-11-21)24(27)28-23-14-16-25(4-2,18-26)17-15-23/h10-13,19-20,23H,3-9,14-17H2,1-2H3 |
| InChIKey | ICYZDXHDGGZMJR-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |