C26H39NO2 — CID 19819361
(4-cyano-4-heptylcyclohexyl) 4-pentylbenzoate (PubChem CID 19819361) has the molecular formula C26H39NO2 and a molecular weight of 397.60 g/mol. Its IUPAC name is (4-cyano-4-heptylcyclohexyl) 4-pentylbenzoate.
| Compound Name | (4-cyano-4-heptylcyclohexyl) 4-pentylbenzoate |
|---|---|
| PubChem CID | 19819361 |
| Molecular Formula | C26H39NO2 |
| Molecular Weight | 397.60 g/mol |
| Exact Mass | 397.30 |
| IUPAC Name | (4-cyano-4-heptylcyclohexyl) 4-pentylbenzoate |
| SMILES | CCCCCCCC1(C#N)CCC(OC(=O)c2ccc(CCCCC)cc2)CC1 |
| InChI | InChI=1S/C26H39NO2/c1-3-5-7-8-10-18-26(21-27)19-16-24(17-20-26)29-25(28)23-14-12-22(13-15-23)11-9-6-4-2/h12-15,24H,3-11,16-20H2,1-2H3 |
| InChIKey | HKLFENSMJITMSZ-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.60 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|