C34H46ClNO3 — CID 139882457
2-[4-[4-(4-cyano-4-octylcyclohexyl)phenyl]phenoxy]ethyl 2-chloro-3-methylbutanoate (PubChem CID 139882457) has the molecular formula C34H46ClNO3 and a molecular weight of 552.20 g/mol. Its IUPAC name is 2-[4-[4-(4-cyano-4-octylcyclohexyl)phenyl]phenoxy]ethyl 2-chloro-3-methylbutanoate.
| Compound Name | 2-[4-[4-(4-cyano-4-octylcyclohexyl)phenyl]phenoxy]ethyl 2-chloro-3-methylbutanoate |
|---|---|
| PubChem CID | 139882457 |
| Molecular Formula | C34H46ClNO3 |
| Molecular Weight | 552.20 g/mol |
| Exact Mass | 551.32 |
| IUPAC Name | 2-[4-[4-(4-cyano-4-octylcyclohexyl)phenyl]phenoxy]ethyl 2-chloro-3-methylbutanoate |
| SMILES | CCCCCCCCC1(C#N)CCC(c2ccc(-c3ccc(OCCOC(=O)C(Cl)C(C)C)cc3)cc2)CC1 |
| InChI | InChI=1S/C34H46ClNO3/c1-4-5-6-7-8-9-20-34(25-36)21-18-30(19-22-34)28-12-10-27(11-13-28)29-14-16-31(17-15-29)38-23-24-39-33(37)32(35)26(2)3/h10-17,26,30,32H,4-9,18-24H2,1-3H3 |
| InChIKey | NUKLQIDBORTNTP-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.20 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|