C26H41NO — CID 19980001
1-(2-methylbutyl)-4-(4-octoxyphenyl)cyclohexane-1-carbonitrile (PubChem CID 19980001) has the molecular formula C26H41NO and a molecular weight of 383.62 g/mol. Its IUPAC name is 1-(2-methylbutyl)-4-(4-octoxyphenyl)cyclohexane-1-carbonitrile.
| Compound Name | 1-(2-methylbutyl)-4-(4-octoxyphenyl)cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 19980001 |
| Molecular Formula | C26H41NO |
| Molecular Weight | 383.62 g/mol |
| Exact Mass | 383.32 |
| IUPAC Name | 1-(2-methylbutyl)-4-(4-octoxyphenyl)cyclohexane-1-carbonitrile |
| SMILES | CCCCCCCCOc1ccc(C2CCC(C#N)(CC(C)CC)CC2)cc1 |
| InChI | InChI=1S/C26H41NO/c1-4-6-7-8-9-10-19-28-25-13-11-23(12-14-25)24-15-17-26(21-27,18-16-24)20-22(3)5-2/h11-14,22,24H,4-10,15-20H2,1-3H3 |
| InChIKey | BDWFFZQZQKJANE-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.62 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|