C31H43N — CID 19103364
4-[4-(4-heptylphenyl)phenyl]-1-(2-methylbutyl)cyclohexane-1-carbonitrile (PubChem CID 19103364) has the molecular formula C31H43N and a molecular weight of 429.69 g/mol. Its IUPAC name is 4-[4-(4-heptylphenyl)phenyl]-1-(2-methylbutyl)cyclohexane-1-carbonitrile.
| Compound Name | 4-[4-(4-heptylphenyl)phenyl]-1-(2-methylbutyl)cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 19103364 |
| Molecular Formula | C31H43N |
| Molecular Weight | 429.69 g/mol |
| Exact Mass | 429.34 |
| IUPAC Name | 4-[4-(4-heptylphenyl)phenyl]-1-(2-methylbutyl)cyclohexane-1-carbonitrile |
| SMILES | CCCCCCCc1ccc(-c2ccc(C3CCC(C#N)(CC(C)CC)CC3)cc2)cc1 |
| InChI | InChI=1S/C31H43N/c1-4-6-7-8-9-10-26-11-13-27(14-12-26)28-15-17-29(18-16-28)30-19-21-31(24-32,22-20-30)23-25(3)5-2/h11-18,25,30H,4-10,19-23H2,1-3H3 |
| InChIKey | BFLZJQBBIMHEEE-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.69 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|