C33H43NO — CID 23041210
4-[4-(4-octylphenyl)phenyl]-1-(3-oxocyclohexyl)cyclohexane-1-carbonitrile (PubChem CID 23041210) has the molecular formula C33H43NO and a molecular weight of 469.71 g/mol. Its IUPAC name is 4-[4-(4-octylphenyl)phenyl]-1-(3-oxocyclohexyl)cyclohexane-1-carbonitrile.
| Compound Name | 4-[4-(4-octylphenyl)phenyl]-1-(3-oxocyclohexyl)cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 23041210 |
| Molecular Formula | C33H43NO |
| Molecular Weight | 469.71 g/mol |
| Exact Mass | 469.33 |
| IUPAC Name | 4-[4-(4-octylphenyl)phenyl]-1-(3-oxocyclohexyl)cyclohexane-1-carbonitrile |
| SMILES | CCCCCCCCc1ccc(-c2ccc(C3CCC(C#N)(C4CCCC(=O)C4)CC3)cc2)cc1 |
| InChI | InChI=1S/C33H43NO/c1-2-3-4-5-6-7-9-26-12-14-27(15-13-26)28-16-18-29(19-17-28)30-20-22-33(25-34,23-21-30)31-10-8-11-32(35)24-31/h12-19,30-31H,2-11,20-24H2,1H3 |
| InChIKey | UVZJVYAUNOFIKG-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.71 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|