C30H37NO2 — CID 23041610
1-(3-oxocyclohexyl)-4-[4-(4-pentoxyphenyl)phenyl]cyclohexane-1-carbonitrile (PubChem CID 23041610) has the molecular formula C30H37NO2 and a molecular weight of 443.63 g/mol. Its IUPAC name is 1-(3-oxocyclohexyl)-4-[4-(4-pentoxyphenyl)phenyl]cyclohexane-1-carbonitrile.
| Compound Name | 1-(3-oxocyclohexyl)-4-[4-(4-pentoxyphenyl)phenyl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 23041610 |
| Molecular Formula | C30H37NO2 |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | 1-(3-oxocyclohexyl)-4-[4-(4-pentoxyphenyl)phenyl]cyclohexane-1-carbonitrile |
| SMILES | CCCCCOc1ccc(-c2ccc(C3CCC(C#N)(C4CCCC(=O)C4)CC3)cc2)cc1 |
| InChI | InChI=1S/C30H37NO2/c1-2-3-4-20-33-29-14-12-25(13-15-29)23-8-10-24(11-9-23)26-16-18-30(22-31,19-17-26)27-6-5-7-28(32)21-27/h8-15,26-27H,2-7,16-21H2,1H3 |
| InChIKey | WSPQCGRLHSTSOO-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|