C29H35NO2 — CID 18640254
4-[4-(4-butoxyphenyl)phenyl]-1-[(1R)-3-oxocyclohexyl]cyclohexane-1-carbonitrile (PubChem CID 18640254) has the molecular formula C29H35NO2 and a molecular weight of 429.60 g/mol. Its IUPAC name is 4-[4-(4-butoxyphenyl)phenyl]-1-[(1R)-3-oxocyclohexyl]cyclohexane-1-carbonitrile.
| Compound Name | 4-[4-(4-butoxyphenyl)phenyl]-1-[(1R)-3-oxocyclohexyl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 18640254 |
| Molecular Formula | C29H35NO2 |
| Molecular Weight | 429.60 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | 4-[4-(4-butoxyphenyl)phenyl]-1-[(1R)-3-oxocyclohexyl]cyclohexane-1-carbonitrile |
| SMILES | CCCCOc1ccc(-c2ccc(C3CCC(C#N)([C@@H]4CCCC(=O)C4)CC3)cc2)cc1 |
| InChI | InChI=1S/C29H35NO2/c1-2-3-19-32-28-13-11-24(12-14-28)22-7-9-23(10-8-22)25-15-17-29(21-30,18-16-25)26-5-4-6-27(31)20-26/h7-14,25-26H,2-6,15-20H2,1H3/t25?,26-,29?/m1/s1 |
| InChIKey | HLXXZLQRTCXISY-QIFBUILRSA-N |
| XLogP | 7.46 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.60 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|